C21H24O2 — CID 90681788
(4aS,4bS,10bR,12aS)-8-acetyl-4a-methyl-1,4b,5,6,10b,11,12,12a-octahydrochrysen-4-one (PubChem CID 90681788) has the molecular formula C21H24O2 and a molecular weight of 308.42 g/mol. Its IUPAC name is (4aS,4bS,10bR,12aS)-8-acetyl-4a-methyl-1,4b,5,6,10b,11,12,12a-octahydrochrysen-4-one.
| Compound Name | (4aS,4bS,10bR,12aS)-8-acetyl-4a-methyl-1,4b,5,6,10b,11,12,12a-octahydrochrysen-4-one |
|---|---|
| PubChem CID | 90681788 |
| Molecular Formula | C21H24O2 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | (4aS,4bS,10bR,12aS)-8-acetyl-4a-methyl-1,4b,5,6,10b,11,12,12a-octahydrochrysen-4-one |
| SMILES | CC(=O)c1ccc2c(c1)CC[C@H]1[C@H]2CC[C@H]2CC=CC(=O)[C@@]21C |
| InChI | InChI=1S/C21H24O2/c1-13(22)14-6-9-17-15(12-14)7-11-19-18(17)10-8-16-4-3-5-20(23)21(16,19)2/h3,5-6,9,12,16,18-19H,4,7-8,10-11H2,1-2H3/t16-,18+,19+,21+/m1/s1 |
| InChIKey | VZBRHWDCTRSWRM-SAJDGTNDSA-N |
| XLogP | 4.48 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |