C15H10IN3O — CID 90681815
14-iodo-6,8,18-triazatetracyclo[9.7.0.02,7.012,17]octadeca-1(11),2(7),3,5,12(17),13,15-heptaen-9-one (PubChem CID 90681815) has the molecular formula C15H10IN3O and a molecular weight of 375.17 g/mol. Its IUPAC name is 14-iodo-6,8,18-triazatetracyclo[9.7.0.02,7.012,17]octadeca-1(11),2(7),3,5,12(17),13,15-heptaen-9-one.
| Compound Name | 14-iodo-6,8,18-triazatetracyclo[9.7.0.02,7.012,17]octadeca-1(11),2(7),3,5,12(17),13,15-heptaen-9-one |
|---|---|
| PubChem CID | 90681815 |
| Molecular Formula | C15H10IN3O |
| Molecular Weight | 375.17 g/mol |
| Exact Mass | 374.99 |
| IUPAC Name | 14-iodo-6,8,18-triazatetracyclo[9.7.0.02,7.012,17]octadeca-1(11),2(7),3,5,12(17),13,15-heptaen-9-one |
| SMILES | O=C1Cc2c([nH]c3ccc(I)cc23)-c2cccnc2N1 |
| InChI | InChI=1S/C15H10IN3O/c16-8-3-4-12-10(6-8)11-7-13(20)19-15-9(14(11)18-12)2-1-5-17-15/h1-6,18H,7H2,(H,17,19,20) |
| InChIKey | VRSTVDLQULQHMV-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.17 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|