C35H44N2O3SSi — CID 90681898
N-[(Z)-[(1S,3aS,5R,6R,6aR)-5-[tert-butyl(diphenyl)silyl]oxy-1-methyl-6-prop-2-enyl-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]amino]-4-methylbenzenesulfonamide (PubChem CID 90681898) has the molecular formula C35H44N2O3SSi and a molecular weight of 600.90 g/mol. Its IUPAC name is N-[(Z)-[(1S,3aS,5R,6R,6aR)-5-[tert-butyl(diphenyl)silyl]oxy-1-methyl-6-prop-2-enyl-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]amino]-4-methylbenzenesulfonamide.
| Compound Name | N-[(Z)-[(1S,3aS,5R,6R,6aR)-5-[tert-butyl(diphenyl)silyl]oxy-1-methyl-6-prop-2-enyl-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]amino]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 90681898 |
| Molecular Formula | C35H44N2O3SSi |
| Molecular Weight | 600.90 g/mol |
| Exact Mass | 600.28 |
| IUPAC Name | N-[(Z)-[(1S,3aS,5R,6R,6aR)-5-[tert-butyl(diphenyl)silyl]oxy-1-methyl-6-prop-2-enyl-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]amino]-4-methylbenzenesulfonamide |
| SMILES | C=CC[C@@H]1[C@@H]2[C@@H](C/C(=N/NS(=O)(=O)c3ccc(C)cc3)[C@H]2C)C[C@H]1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C35H44N2O3SSi/c1-7-14-31-33(40-42(35(4,5)6,29-15-10-8-11-16-29)30-17-12-9-13-18-30)24-27-23-32(26(3)34(27)31)36-37-41(38,39)28-21-19-25(2)20-22-28/h7-13,15-22,26-27,31,33-34,37H,1,14,23-24H2,2-6H3/b36-32-/t26-,27+,31+,33-,34+/m1/s1 |
| InChIKey | JVWWAWIDJXEWSF-NVKWPQGZSA-N |
| XLogP | 6.44 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.90 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|