C12H14O2 — CID 90681903
(3S,3aR,6aR)-3-but-3-enyl-2,3,3a,6a-tetrahydropentalene-1,4-dione (PubChem CID 90681903) has the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. Its IUPAC name is (3S,3aR,6aR)-3-but-3-enyl-2,3,3a,6a-tetrahydropentalene-1,4-dione.
| Compound Name | (3S,3aR,6aR)-3-but-3-enyl-2,3,3a,6a-tetrahydropentalene-1,4-dione |
|---|---|
| PubChem CID | 90681903 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | (3S,3aR,6aR)-3-but-3-enyl-2,3,3a,6a-tetrahydropentalene-1,4-dione |
| SMILES | C=CCC[C@H]1CC(=O)[C@@H]2C=CC(=O)[C@H]12 |
| InChI | InChI=1S/C12H14O2/c1-2-3-4-8-7-11(14)9-5-6-10(13)12(8)9/h2,5-6,8-9,12H,1,3-4,7H2/t8-,9-,12+/m0/s1 |
| InChIKey | NGQJLNPBSNIYLX-HOTUBEGUSA-N |
| XLogP | 1.91 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|