C18H24O7 — CID 90681916
[(1R,3S,10R,11S,14R)-10-hydroxy-6,6,13,13-tetramethyl-8-oxo-2,5,12-trioxatetracyclo[9.4.0.01,3.04,9]pentadec-4(9)-en-14-yl] acetate (PubChem CID 90681916) has the molecular formula C18H24O7 and a molecular weight of 352.38 g/mol. Its IUPAC name is [(1R,3S,10R,11S,14R)-10-hydroxy-6,6,13,13-tetramethyl-8-oxo-2,5,12-trioxatetracyclo[9.4.0.01,3.04,9]pentadec-4(9)-en-14-yl] acetate.
| Compound Name | [(1R,3S,10R,11S,14R)-10-hydroxy-6,6,13,13-tetramethyl-8-oxo-2,5,12-trioxatetracyclo[9.4.0.01,3.04,9]pentadec-4(9)-en-14-yl] acetate |
|---|---|
| PubChem CID | 90681916 |
| Molecular Formula | C18H24O7 |
| Molecular Weight | 352.38 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | [(1R,3S,10R,11S,14R)-10-hydroxy-6,6,13,13-tetramethyl-8-oxo-2,5,12-trioxatetracyclo[9.4.0.01,3.04,9]pentadec-4(9)-en-14-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@]23O[C@H]2C2=C(C(=O)CC(C)(C)O2)[C@@H](O)[C@@H]3OC1(C)C |
| InChI | InChI=1S/C18H24O7/c1-8(19)22-10-7-18-14(24-17(10,4)5)12(21)11-9(20)6-16(2,3)23-13(11)15(18)25-18/h10,12,14-15,21H,6-7H2,1-5H3/t10-,12-,14+,15+,18-/m1/s1 |
| InChIKey | QTHPDXJRVSEFDY-FYEODOKUSA-N |
| XLogP | 1.02 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.38 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|