About 2-(2-aminoimidazo[4,5-c]pyridin-1-yl)-1-(2,4-dichlorophenyl)ethanol
2-(2-aminoimidazo[4,5-c]pyridin-1-yl)-1-(2,4-dichlorophenyl)ethanol (PubChem CID 90681920) has the molecular formula C14H12Cl2N4O
and a molecular weight of 323.18 g/mol. Its IUPAC name is 2-(2-aminoimidazo[4,5-c]pyridin-1-yl)-1-(2,4-dichlorophenyl)ethanol.
Molecular Properties
| Compound Name | 2-(2-aminoimidazo[4,5-c]pyridin-1-yl)-1-(2,4-dichlorophenyl)ethanol |
| PubChem CID | 90681920 |
| Molecular Formula | C14H12Cl2N4O |
| Molecular Weight | 323.18 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | 2-(2-aminoimidazo[4,5-c]pyridin-1-yl)-1-(2,4-dichlorophenyl)ethanol |
| SMILES | Nc1nc2cnccc2n1CC(O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H12Cl2N4O/c15-8-1-2-9(10(16)5-8)13(21)7-20-12-3-4-18-6-11(12)19-14(20)17/h1-6,13,21H,7H2,(H2,17,19) |
| InChIKey | OACHPELDNFYCMN-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.18 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2-aminoimidazo[4,5-c]pyridin-1-yl)-1-(2,4-dichlorophenyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-aminoimidazo[4,5-c]pyridin-1-yl)-1-(2,4-dichlorophenyl)ethanol?
The IUPAC name of 2-(2-aminoimidazo[4,5-c]pyridin-1-yl)-1-(2,4-dichlorophenyl)ethanol (CID 90681920) is 2-(2-aminoimidazo[4,5-c]pyridin-1-yl)-1-(2,4-dichlorophenyl)ethanol.
What is the SMILES notation for 2-(2-aminoimidazo[4,5-c]pyridin-1-yl)-1-(2,4-dichlorophenyl)ethanol?
The canonical SMILES for 2-(2-aminoimidazo[4,5-c]pyridin-1-yl)-1-(2,4-dichlorophenyl)ethanol is Nc1nc2cnccc2n1CC(O)c1ccc(Cl)cc1Cl.
What is the InChIKey of 2-(2-aminoimidazo[4,5-c]pyridin-1-yl)-1-(2,4-dichlorophenyl)ethanol?
The InChIKey is OACHPELDNFYCMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12Cl2N4O/c15-8-1-2-9(10(16)5-8)13(21)7-20-12-3-4-18-6-11(12)19-14(20)17/h1-6,13,21H,7H2,(H2,17,19).
What are the key properties of 2-(2-aminoimidazo[4,5-c]pyridin-1-yl)-1-(2,4-dichlorophenyl)ethanol?
2-(2-aminoimidazo[4,5-c]pyridin-1-yl)-1-(2,4-dichlorophenyl)ethanol has a molecular weight of 323.18 g/mol, XLogP of 3.05, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-aminoimidazo[4,5-c]pyridin-1-yl)-1-(2,4-dichlorophenyl)ethanol is sourced from PubChem (CID 90681920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).