C27H36O2Si — CID 90682006
(3aR,4R,5R,6aR)-5-[tert-butyl(diphenyl)silyl]oxy-3a,4,6a-trimethyl-3,4,5,6-tetrahydro-1H-pentalen-2-one (PubChem CID 90682006) has the molecular formula C27H36O2Si and a molecular weight of 420.67 g/mol. Its IUPAC name is (3aR,4R,5R,6aR)-5-[tert-butyl(diphenyl)silyl]oxy-3a,4,6a-trimethyl-3,4,5,6-tetrahydro-1H-pentalen-2-one.
| Compound Name | (3aR,4R,5R,6aR)-5-[tert-butyl(diphenyl)silyl]oxy-3a,4,6a-trimethyl-3,4,5,6-tetrahydro-1H-pentalen-2-one |
|---|---|
| PubChem CID | 90682006 |
| Molecular Formula | C27H36O2Si |
| Molecular Weight | 420.67 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | (3aR,4R,5R,6aR)-5-[tert-butyl(diphenyl)silyl]oxy-3a,4,6a-trimethyl-3,4,5,6-tetrahydro-1H-pentalen-2-one |
| SMILES | C[C@H]1[C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C[C@]2(C)CC(=O)C[C@]12C |
| InChI | InChI=1S/C27H36O2Si/c1-20-24(19-26(5)17-21(28)18-27(20,26)6)29-30(25(2,3)4,22-13-9-7-10-14-22)23-15-11-8-12-16-23/h7-16,20,24H,17-19H2,1-6H3/t20-,24+,26-,27+/m0/s1 |
| InChIKey | BNMZCBZDVVDLIH-MUDGOKMXSA-N |
| XLogP | 5.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.67 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|