C22H32O3 — CID 90682009
(3'aS,6'aR)-5,5-dimethyl-2'-(2,4,6-trimethylphenoxy)spiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene] (PubChem CID 90682009) has the molecular formula C22H32O3 and a molecular weight of 344.50 g/mol. Its IUPAC name is (3'aS,6'aR)-5,5-dimethyl-2'-(2,4,6-trimethylphenoxy)spiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene].
| Compound Name | (3'aS,6'aR)-5,5-dimethyl-2'-(2,4,6-trimethylphenoxy)spiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene] |
|---|---|
| PubChem CID | 90682009 |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | (3'aS,6'aR)-5,5-dimethyl-2'-(2,4,6-trimethylphenoxy)spiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene] |
| SMILES | Cc1cc(C)c(OC2C[C@@H]3CC4(C[C@@H]3C2)OCC(C)(C)CO4)c(C)c1 |
| InChI | InChI=1S/C22H32O3/c1-14-6-15(2)20(16(3)7-14)25-19-8-17-10-22(11-18(17)9-19)23-12-21(4,5)13-24-22/h6-7,17-19H,8-13H2,1-5H3/t17-,18+,19? |
| InChIKey | FGQZLYDGVXZEFD-DFNIBXOVSA-N |
| XLogP | 4.95 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |