C14H20O4 — CID 90682019
4-[(3aR,6aR)-3-oxospiro[1,2,3a,5,6,6a-hexahydropentalene-4,2'-1,3-dioxolane]-1-yl]butanal (PubChem CID 90682019) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is 4-[(3aR,6aR)-3-oxospiro[1,2,3a,5,6,6a-hexahydropentalene-4,2'-1,3-dioxolane]-1-yl]butanal.
| Compound Name | 4-[(3aR,6aR)-3-oxospiro[1,2,3a,5,6,6a-hexahydropentalene-4,2'-1,3-dioxolane]-1-yl]butanal |
|---|---|
| PubChem CID | 90682019 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 4-[(3aR,6aR)-3-oxospiro[1,2,3a,5,6,6a-hexahydropentalene-4,2'-1,3-dioxolane]-1-yl]butanal |
| SMILES | O=CCCCC1CC(=O)[C@H]2[C@@H]1CCC21OCCO1 |
| InChI | InChI=1S/C14H20O4/c15-6-2-1-3-10-9-12(16)13-11(10)4-5-14(13)17-7-8-18-14/h6,10-11,13H,1-5,7-9H2/t10?,11-,13-/m1/s1 |
| InChIKey | CDUPIUFQFXCXCW-LIXJUXSLSA-N |
| XLogP | 1.71 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|