C14H22O4 — CID 90682020
(3'aR,6'aR)-3'-(4-hydroxybutyl)spiro[1,3-dioxolane-2,6'-2,3,3a,4,5,6a-hexahydropentalene]-1'-one (PubChem CID 90682020) has the molecular formula C14H22O4 and a molecular weight of 254.33 g/mol. Its IUPAC name is (3'aR,6'aR)-3'-(4-hydroxybutyl)spiro[1,3-dioxolane-2,6'-2,3,3a,4,5,6a-hexahydropentalene]-1'-one.
| Compound Name | (3'aR,6'aR)-3'-(4-hydroxybutyl)spiro[1,3-dioxolane-2,6'-2,3,3a,4,5,6a-hexahydropentalene]-1'-one |
|---|---|
| PubChem CID | 90682020 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | (3'aR,6'aR)-3'-(4-hydroxybutyl)spiro[1,3-dioxolane-2,6'-2,3,3a,4,5,6a-hexahydropentalene]-1'-one |
| SMILES | O=C1CC(CCCCO)[C@H]2CCC3(OCCO3)[C@@H]12 |
| InChI | InChI=1S/C14H22O4/c15-6-2-1-3-10-9-12(16)13-11(10)4-5-14(13)17-7-8-18-14/h10-11,13,15H,1-9H2/t10?,11-,13-/m1/s1 |
| InChIKey | ZGJUVXLNLYHWAR-LIXJUXSLSA-N |
| XLogP | 1.51 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|