C20H33BrO4Si — CID 90682024
(3'aS,8'bS)-2'-bromo-5'-[tert-butyl(dimethyl)silyl]oxyspiro[1,3-dioxolane-2,1'-2,3,3a,4a,5,6,7,8,8a,8b-decahydrocyclopenta[a]indene]-4'-one (PubChem CID 90682024) has the molecular formula C20H33BrO4Si and a molecular weight of 445.47 g/mol. Its IUPAC name is (3'aS,8'bS)-2'-bromo-5'-[tert-butyl(dimethyl)silyl]oxyspiro[1,3-dioxolane-2,1'-2,3,3a,4a,5,6,7,8,8a,8b-decahydrocyclopenta[a]indene]-4'-one.
| Compound Name | (3'aS,8'bS)-2'-bromo-5'-[tert-butyl(dimethyl)silyl]oxyspiro[1,3-dioxolane-2,1'-2,3,3a,4a,5,6,7,8,8a,8b-decahydrocyclopenta[a]indene]-4'-one |
|---|---|
| PubChem CID | 90682024 |
| Molecular Formula | C20H33BrO4Si |
| Molecular Weight | 445.47 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | (3'aS,8'bS)-2'-bromo-5'-[tert-butyl(dimethyl)silyl]oxyspiro[1,3-dioxolane-2,1'-2,3,3a,4a,5,6,7,8,8a,8b-decahydrocyclopenta[a]indene]-4'-one |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCCC2C1C(=O)[C@H]1CC(Br)C3(OCCO3)[C@@H]21 |
| InChI | InChI=1S/C20H33BrO4Si/c1-19(2,3)26(4,5)25-14-8-6-7-12-16(14)18(22)13-11-15(21)20(17(12)13)23-9-10-24-20/h12-17H,6-11H2,1-5H3/t12?,13-,14?,15?,16?,17-/m0/s1 |
| InChIKey | VNTNHARVKKWVGM-DETBXZTBSA-N |
| XLogP | 4.52 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.47 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|