About ethyl 2-amino-6-oxo-4-phenyl-4,5-dihydro-1H-pyrimidine-5-carboxylate
ethyl 2-amino-6-oxo-4-phenyl-4,5-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 90682080) has the molecular formula C13H15N3O3
and a molecular weight of 261.28 g/mol. Its IUPAC name is ethyl 2-amino-6-oxo-4-phenyl-4,5-dihydro-1H-pyrimidine-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-amino-6-oxo-4-phenyl-4,5-dihydro-1H-pyrimidine-5-carboxylate |
| PubChem CID | 90682080 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | ethyl 2-amino-6-oxo-4-phenyl-4,5-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1C(=O)NC(N)=NC1c1ccccc1 |
| InChI | InChI=1S/C13H15N3O3/c1-2-19-12(18)9-10(8-6-4-3-5-7-8)15-13(14)16-11(9)17/h3-7,9-10H,2H2,1H3,(H3,14,15,16,17) |
| InChIKey | IBBMKLYVHVMJST-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-amino-6-oxo-4-phenyl-4,5-dihydro-1H-pyrimidine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-amino-6-oxo-4-phenyl-4,5-dihydro-1H-pyrimidine-5-carboxylate?
The IUPAC name of ethyl 2-amino-6-oxo-4-phenyl-4,5-dihydro-1H-pyrimidine-5-carboxylate (CID 90682080) is ethyl 2-amino-6-oxo-4-phenyl-4,5-dihydro-1H-pyrimidine-5-carboxylate.
What is the SMILES notation for ethyl 2-amino-6-oxo-4-phenyl-4,5-dihydro-1H-pyrimidine-5-carboxylate?
The canonical SMILES for ethyl 2-amino-6-oxo-4-phenyl-4,5-dihydro-1H-pyrimidine-5-carboxylate is CCOC(=O)C1C(=O)NC(N)=NC1c1ccccc1.
What is the InChIKey of ethyl 2-amino-6-oxo-4-phenyl-4,5-dihydro-1H-pyrimidine-5-carboxylate?
The InChIKey is IBBMKLYVHVMJST-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3O3/c1-2-19-12(18)9-10(8-6-4-3-5-7-8)15-13(14)16-11(9)17/h3-7,9-10H,2H2,1H3,(H3,14,15,16,17).
What are the key properties of ethyl 2-amino-6-oxo-4-phenyl-4,5-dihydro-1H-pyrimidine-5-carboxylate?
ethyl 2-amino-6-oxo-4-phenyl-4,5-dihydro-1H-pyrimidine-5-carboxylate has a molecular weight of 261.28 g/mol, XLogP of 0.35, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-amino-6-oxo-4-phenyl-4,5-dihydro-1H-pyrimidine-5-carboxylate is sourced from PubChem (CID 90682080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).