C13H13Cl2N3O3 — CID 90682082
ethyl 2-amino-4-(2,4-dichlorophenyl)-6-oxo-4,5-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 90682082) has the molecular formula C13H13Cl2N3O3 and a molecular weight of 330.17 g/mol. Its IUPAC name is ethyl 2-amino-4-(2,4-dichlorophenyl)-6-oxo-4,5-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl 2-amino-4-(2,4-dichlorophenyl)-6-oxo-4,5-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 90682082 |
| Molecular Formula | C13H13Cl2N3O3 |
| Molecular Weight | 330.17 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | ethyl 2-amino-4-(2,4-dichlorophenyl)-6-oxo-4,5-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1C(=O)NC(N)=NC1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H13Cl2N3O3/c1-2-21-12(20)9-10(17-13(16)18-11(9)19)7-4-3-6(14)5-8(7)15/h3-5,9-10H,2H2,1H3,(H3,16,17,18,19) |
| InChIKey | XSTLVFALSGCHGQ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.17 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|