C32H26N2O3 — CID 90682158
3-[[6-[3-[(3-methoxyphenyl)methyl]-1H-indol-6-yl]indol-1-yl]methyl]benzoic acid (PubChem CID 90682158) has the molecular formula C32H26N2O3 and a molecular weight of 486.57 g/mol. Its IUPAC name is 3-[[6-[3-[(3-methoxyphenyl)methyl]-1H-indol-6-yl]indol-1-yl]methyl]benzoic acid.
| Compound Name | 3-[[6-[3-[(3-methoxyphenyl)methyl]-1H-indol-6-yl]indol-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 90682158 |
| Molecular Formula | C32H26N2O3 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | 3-[[6-[3-[(3-methoxyphenyl)methyl]-1H-indol-6-yl]indol-1-yl]methyl]benzoic acid |
| SMILES | COc1cccc(Cc2c[nH]c3cc(-c4ccc5ccn(Cc6cccc(C(=O)O)c6)c5c4)ccc23)c1 |
| InChI | InChI=1S/C32H26N2O3/c1-37-28-7-3-4-21(16-28)14-27-19-33-30-17-24(10-11-29(27)30)25-9-8-23-12-13-34(31(23)18-25)20-22-5-2-6-26(15-22)32(35)36/h2-13,15-19,33H,14,20H2,1H3,(H,35,36) |
| InChIKey | FXQMTBQQAJAZGD-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 67.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |