C19H16O3 — CID 90682170
(1E,4E,6E)-1,7-bis(3-hydroxyphenyl)hepta-1,4,6-trien-3-one (PubChem CID 90682170) has the molecular formula C19H16O3 and a molecular weight of 292.33 g/mol. Its IUPAC name is (1E,4E,6E)-1,7-bis(3-hydroxyphenyl)hepta-1,4,6-trien-3-one.
| Compound Name | (1E,4E,6E)-1,7-bis(3-hydroxyphenyl)hepta-1,4,6-trien-3-one |
|---|---|
| PubChem CID | 90682170 |
| Molecular Formula | C19H16O3 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | (1E,4E,6E)-1,7-bis(3-hydroxyphenyl)hepta-1,4,6-trien-3-one |
| SMILES | O=C(/C=C/C=C/c1cccc(O)c1)/C=C/c1cccc(O)c1 |
| InChI | InChI=1S/C19H16O3/c20-17(12-11-16-7-4-10-19(22)14-16)8-2-1-5-15-6-3-9-18(21)13-15/h1-14,21-22H/b5-1+,8-2+,12-11+ |
| InChIKey | BVAXPPCFBCMRSU-ZILRBQDHSA-N |
| XLogP | 3.95 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|