C23H28ClN3O — CID 90682269
2-(5-aminopentyl)-5,6,11-trimethylpyrido[4,3-b]carbazol-2-ium-9-ol chloride (PubChem CID 90682269) has the molecular formula C23H28ClN3O and a molecular weight of 397.95 g/mol. Its IUPAC name is 2-(5-aminopentyl)-5,6,11-trimethylpyrido[4,3-b]carbazol-2-ium-9-ol chloride.
| Compound Name | 2-(5-aminopentyl)-5,6,11-trimethylpyrido[4,3-b]carbazol-2-ium-9-ol chloride |
|---|---|
| PubChem CID | 90682269 |
| Molecular Formula | C23H28ClN3O |
| Molecular Weight | 397.95 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | 2-(5-aminopentyl)-5,6,11-trimethylpyrido[4,3-b]carbazol-2-ium-9-ol chloride |
| SMILES | Cc1c2c[n+](CCCCCN)ccc2c(C)c2c1c1cc(O)ccc1n2C.[Cl-] |
| InChI | InChI=1S/C23H27N3O.ClH/c1-15-20-14-26(11-6-4-5-10-24)12-9-18(20)16(2)23-22(15)19-13-17(27)7-8-21(19)25(23)3;/h7-9,12-14H,4-6,10-11,24H2,1-3H3;1H |
| InChIKey | CXEYXZQTLMDDAX-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 55.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.95 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|