C21H24ClN3O2 — CID 90682277
2-[2-(2-aminoethoxy)ethyl]-5,11-dimethyl-6H-pyrido[4,3-b]carbazol-2-ium-9-ol chloride (PubChem CID 90682277) has the molecular formula C21H24ClN3O2 and a molecular weight of 385.90 g/mol. Its IUPAC name is 2-[2-(2-aminoethoxy)ethyl]-5,11-dimethyl-6H-pyrido[4,3-b]carbazol-2-ium-9-ol chloride.
| Compound Name | 2-[2-(2-aminoethoxy)ethyl]-5,11-dimethyl-6H-pyrido[4,3-b]carbazol-2-ium-9-ol chloride |
|---|---|
| PubChem CID | 90682277 |
| Molecular Formula | C21H24ClN3O2 |
| Molecular Weight | 385.90 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 2-[2-(2-aminoethoxy)ethyl]-5,11-dimethyl-6H-pyrido[4,3-b]carbazol-2-ium-9-ol chloride |
| SMILES | Cc1c2cc[n+](CCOCCN)cc2c(C)c2c1[nH]c1ccc(O)cc12.[Cl-] |
| InChI | InChI=1S/C21H23N3O2.ClH/c1-13-18-12-24(8-10-26-9-6-22)7-5-16(18)14(2)21-20(13)17-11-15(25)3-4-19(17)23-21;/h3-5,7,11-12,25H,6,8-10,22H2,1-2H3;1H |
| InChIKey | WLYISEVXYFAALU-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 75.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.90 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|