About [1-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyethyl] 2-[4-(2-methylpropyl)phenyl]propanoate
[1-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyethyl] 2-[4-(2-methylpropyl)phenyl]propanoate (PubChem CID 90682309) has the molecular formula C19H24O7
and a molecular weight of 364.39 g/mol. Its IUPAC name is [1-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyethyl] 2-[4-(2-methylpropyl)phenyl]propanoate.
Molecular Properties
| Compound Name | [1-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyethyl] 2-[4-(2-methylpropyl)phenyl]propanoate |
| PubChem CID | 90682309 |
| Molecular Formula | C19H24O7 |
| Molecular Weight | 364.39 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | [1-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyethyl] 2-[4-(2-methylpropyl)phenyl]propanoate |
| SMILES | CC(C)Cc1ccc(C(C)C(=O)OC(CO)C2OC(=O)C(O)=C2O)cc1 |
| InChI | InChI=1S/C19H24O7/c1-10(2)8-12-4-6-13(7-5-12)11(3)18(23)25-14(9-20)17-15(21)16(22)19(24)26-17/h4-7,10-11,14,17,20-22H,8-9H2,1-3H3 |
| InChIKey | YNKKAGIHMCBODM-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.39 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [1-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyethyl] 2-[4-(2-methylpropyl)phenyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyethyl] 2-[4-(2-methylpropyl)phenyl]propanoate?
The IUPAC name of [1-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyethyl] 2-[4-(2-methylpropyl)phenyl]propanoate (CID 90682309) is [1-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyethyl] 2-[4-(2-methylpropyl)phenyl]propanoate.
What is the SMILES notation for [1-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyethyl] 2-[4-(2-methylpropyl)phenyl]propanoate?
The canonical SMILES for [1-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyethyl] 2-[4-(2-methylpropyl)phenyl]propanoate is CC(C)Cc1ccc(C(C)C(=O)OC(CO)C2OC(=O)C(O)=C2O)cc1.
What is the InChIKey of [1-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyethyl] 2-[4-(2-methylpropyl)phenyl]propanoate?
The InChIKey is YNKKAGIHMCBODM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24O7/c1-10(2)8-12-4-6-13(7-5-12)11(3)18(23)25-14(9-20)17-15(21)16(22)19(24)26-17/h4-7,10-11,14,17,20-22H,8-9H2,1-3H3.
What are the key properties of [1-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyethyl] 2-[4-(2-methylpropyl)phenyl]propanoate?
[1-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyethyl] 2-[4-(2-methylpropyl)phenyl]propanoate has a molecular weight of 364.39 g/mol, XLogP of 2.15, 7 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyethyl] 2-[4-(2-methylpropyl)phenyl]propanoate is sourced from PubChem (CID 90682309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).