About benzo[c][1,6]naphthyridin-6-amine
benzo[c][1,6]naphthyridin-6-amine (PubChem CID 90682325) has the molecular formula C12H9N3
and a molecular weight of 195.23 g/mol. Its IUPAC name is benzo[c][1,6]naphthyridin-6-amine.
Molecular Properties
| Compound Name | benzo[c][1,6]naphthyridin-6-amine |
| PubChem CID | 90682325 |
| Molecular Formula | C12H9N3 |
| Molecular Weight | 195.23 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | benzo[c][1,6]naphthyridin-6-amine |
| SMILES | Nc1nc2ccncc2c2ccccc12 |
| InChI | InChI=1S/C12H9N3/c13-12-9-4-2-1-3-8(9)10-7-14-6-5-11(10)15-12/h1-7H,(H2,13,15) |
| InChIKey | WZLNCFWMARKSSU-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.23 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze benzo[c][1,6]naphthyridin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[c][1,6]naphthyridin-6-amine?
The IUPAC name of benzo[c][1,6]naphthyridin-6-amine (CID 90682325) is benzo[c][1,6]naphthyridin-6-amine.
What is the SMILES notation for benzo[c][1,6]naphthyridin-6-amine?
The canonical SMILES for benzo[c][1,6]naphthyridin-6-amine is Nc1nc2ccncc2c2ccccc12.
What is the InChIKey of benzo[c][1,6]naphthyridin-6-amine?
The InChIKey is WZLNCFWMARKSSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N3/c13-12-9-4-2-1-3-8(9)10-7-14-6-5-11(10)15-12/h1-7H,(H2,13,15).
What are the key properties of benzo[c][1,6]naphthyridin-6-amine?
benzo[c][1,6]naphthyridin-6-amine has a molecular weight of 195.23 g/mol, XLogP of 2.37, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[c][1,6]naphthyridin-6-amine is sourced from PubChem (CID 90682325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).