C19H21N5O2 — CID 90682475
4-[[1-(1-methylpyrazole-4-carbonyl)piperidin-4-yl]amino]-1H-quinolin-2-one (PubChem CID 90682475) has the molecular formula C19H21N5O2 and a molecular weight of 351.41 g/mol. Its IUPAC name is 4-[[1-(1-methylpyrazole-4-carbonyl)piperidin-4-yl]amino]-1H-quinolin-2-one.
| Compound Name | 4-[[1-(1-methylpyrazole-4-carbonyl)piperidin-4-yl]amino]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 90682475 |
| Molecular Formula | C19H21N5O2 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | 4-[[1-(1-methylpyrazole-4-carbonyl)piperidin-4-yl]amino]-1H-quinolin-2-one |
| SMILES | Cn1cc(C(=O)N2CCC(Nc3cc(=O)[nH]c4ccccc34)CC2)cn1 |
| InChI | InChI=1S/C19H21N5O2/c1-23-12-13(11-20-23)19(26)24-8-6-14(7-9-24)21-17-10-18(25)22-16-5-3-2-4-15(16)17/h2-5,10-12,14H,6-9H2,1H3,(H2,21,22,25) |
| InChIKey | DKMOXXHHIYAULE-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 83.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |