About 4-[[1-(1,5-dimethylpyrazole-4-carbonyl)piperidin-4-yl]amino]-1H-quinolin-2-one
4-[[1-(1,5-dimethylpyrazole-4-carbonyl)piperidin-4-yl]amino]-1H-quinolin-2-one (PubChem CID 90682476) has the molecular formula C20H23N5O2
and a molecular weight of 365.44 g/mol. Its IUPAC name is 4-[[1-(1,5-dimethylpyrazole-4-carbonyl)piperidin-4-yl]amino]-1H-quinolin-2-one.
Molecular Properties
| Compound Name | 4-[[1-(1,5-dimethylpyrazole-4-carbonyl)piperidin-4-yl]amino]-1H-quinolin-2-one |
| PubChem CID | 90682476 |
| Molecular Formula | C20H23N5O2 |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 4-[[1-(1,5-dimethylpyrazole-4-carbonyl)piperidin-4-yl]amino]-1H-quinolin-2-one |
| SMILES | Cc1c(C(=O)N2CCC(Nc3cc(=O)[nH]c4ccccc34)CC2)cnn1C |
| InChI | InChI=1S/C20H23N5O2/c1-13-16(12-21-24(13)2)20(27)25-9-7-14(8-10-25)22-18-11-19(26)23-17-6-4-3-5-15(17)18/h3-6,11-12,14H,7-10H2,1-2H3,(H2,22,23,26) |
| InChIKey | RHXRDLVDRCUTRK-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 83.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[[1-(1,5-dimethylpyrazole-4-carbonyl)piperidin-4-yl]amino]-1H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[1-(1,5-dimethylpyrazole-4-carbonyl)piperidin-4-yl]amino]-1H-quinolin-2-one?
The IUPAC name of 4-[[1-(1,5-dimethylpyrazole-4-carbonyl)piperidin-4-yl]amino]-1H-quinolin-2-one (CID 90682476) is 4-[[1-(1,5-dimethylpyrazole-4-carbonyl)piperidin-4-yl]amino]-1H-quinolin-2-one.
What is the SMILES notation for 4-[[1-(1,5-dimethylpyrazole-4-carbonyl)piperidin-4-yl]amino]-1H-quinolin-2-one?
The canonical SMILES for 4-[[1-(1,5-dimethylpyrazole-4-carbonyl)piperidin-4-yl]amino]-1H-quinolin-2-one is Cc1c(C(=O)N2CCC(Nc3cc(=O)[nH]c4ccccc34)CC2)cnn1C.
What is the InChIKey of 4-[[1-(1,5-dimethylpyrazole-4-carbonyl)piperidin-4-yl]amino]-1H-quinolin-2-one?
The InChIKey is RHXRDLVDRCUTRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23N5O2/c1-13-16(12-21-24(13)2)20(27)25-9-7-14(8-10-25)22-18-11-19(26)23-17-6-4-3-5-15(17)18/h3-6,11-12,14H,7-10H2,1-2H3,(H2,22,23,26).
What are the key properties of 4-[[1-(1,5-dimethylpyrazole-4-carbonyl)piperidin-4-yl]amino]-1H-quinolin-2-one?
4-[[1-(1,5-dimethylpyrazole-4-carbonyl)piperidin-4-yl]amino]-1H-quinolin-2-one has a molecular weight of 365.44 g/mol, XLogP of 2.29, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[1-(1,5-dimethylpyrazole-4-carbonyl)piperidin-4-yl]amino]-1H-quinolin-2-one is sourced from PubChem (CID 90682476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).