C27H37NO5S — CID 90682507
[(1S,2R,3S,4S,6R,7R,8R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[(5-hydroxy-3-pyridinyl)sulfanyl]acetate (PubChem CID 90682507) has the molecular formula C27H37NO5S and a molecular weight of 487.66 g/mol. Its IUPAC name is [(1S,2R,3S,4S,6R,7R,8R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[(5-hydroxy-3-pyridinyl)sulfanyl]acetate.
| Compound Name | [(1S,2R,3S,4S,6R,7R,8R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[(5-hydroxy-3-pyridinyl)sulfanyl]acetate |
|---|---|
| PubChem CID | 90682507 |
| Molecular Formula | C27H37NO5S |
| Molecular Weight | 487.66 g/mol |
| Exact Mass | 487.24 |
| IUPAC Name | [(1S,2R,3S,4S,6R,7R,8R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[(5-hydroxy-3-pyridinyl)sulfanyl]acetate |
| SMILES | C=C[C@]1(C)C[C@@H](OC(=O)CSc2cncc(O)c2)[C@]2(C)[C@H](C)CC[C@]3(CCC(=O)[C@H]32)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C27H37NO5S/c1-6-25(4)12-21(33-22(31)15-34-19-11-18(29)13-28-14-19)26(5)16(2)7-9-27(17(3)24(25)32)10-8-20(30)23(26)27/h6,11,13-14,16-17,21,23-24,29,32H,1,7-10,12,15H2,2-5H3/t16-,17+,21-,23+,24+,25-,26+,27+/m1/s1 |
| InChIKey | MENGAYVUMXAGJD-PLQLVBBOSA-N |
| XLogP | 4.79 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.66 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|