C28H39NO5S — CID 90682656
[(1S,2R,3S,4S,6R,7R,8R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[[2-(hydroxymethyl)-4-pyridinyl]sulfanyl]acetate (PubChem CID 90682656) has the molecular formula C28H39NO5S and a molecular weight of 501.69 g/mol. Its IUPAC name is [(1S,2R,3S,4S,6R,7R,8R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[[2-(hydroxymethyl)-4-pyridinyl]sulfanyl]acetate.
| Compound Name | [(1S,2R,3S,4S,6R,7R,8R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[[2-(hydroxymethyl)-4-pyridinyl]sulfanyl]acetate |
|---|---|
| PubChem CID | 90682656 |
| Molecular Formula | C28H39NO5S |
| Molecular Weight | 501.69 g/mol |
| Exact Mass | 501.25 |
| IUPAC Name | [(1S,2R,3S,4S,6R,7R,8R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[[2-(hydroxymethyl)-4-pyridinyl]sulfanyl]acetate |
| SMILES | C=C[C@]1(C)C[C@@H](OC(=O)CSc2ccnc(CO)c2)[C@]2(C)[C@H](C)CC[C@]3(CCC(=O)[C@H]32)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C28H39NO5S/c1-6-26(4)14-22(34-23(32)16-35-20-9-12-29-19(13-20)15-30)27(5)17(2)7-10-28(18(3)25(26)33)11-8-21(31)24(27)28/h6,9,12-13,17-18,22,24-25,30,33H,1,7-8,10-11,14-16H2,2-5H3/t17-,18+,22-,24+,25+,26-,27+,28+/m1/s1 |
| InChIKey | HREZBSMCGIYRMW-HMQJICCGSA-N |
| XLogP | 4.57 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.69 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|