C28H32BrNO4 — CID 90682744
[(3S,8R,9S,10R,13S,14S)-17-acetyl-10,13-dimethyl-6-oxo-1,2,3,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-yl] N-(4-bromophenyl)carbamate (PubChem CID 90682744) has the molecular formula C28H32BrNO4 and a molecular weight of 526.47 g/mol. Its IUPAC name is [(3S,8R,9S,10R,13S,14S)-17-acetyl-10,13-dimethyl-6-oxo-1,2,3,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-yl] N-(4-bromophenyl)carbamate.
| Compound Name | [(3S,8R,9S,10R,13S,14S)-17-acetyl-10,13-dimethyl-6-oxo-1,2,3,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-yl] N-(4-bromophenyl)carbamate |
|---|---|
| PubChem CID | 90682744 |
| Molecular Formula | C28H32BrNO4 |
| Molecular Weight | 526.47 g/mol |
| Exact Mass | 525.15 |
| IUPAC Name | [(3S,8R,9S,10R,13S,14S)-17-acetyl-10,13-dimethyl-6-oxo-1,2,3,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-yl] N-(4-bromophenyl)carbamate |
| SMILES | CC(=O)C1=CC[C@H]2[C@@H]3CC(=O)C4=C[C@@H](OC(=O)Nc5ccc(Br)cc5)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C28H32BrNO4/c1-16(31)21-8-9-22-20-15-25(32)24-14-19(34-26(33)30-18-6-4-17(29)5-7-18)10-12-28(24,3)23(20)11-13-27(21,22)2/h4-8,14,19-20,22-23H,9-13,15H2,1-3H3,(H,30,33)/t19-,20-,22-,23-,27+,28+/m0/s1 |
| InChIKey | GFLOFSOPBDCISZ-BDVCAQFBSA-N |
| XLogP | 6.63 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.47 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |