C14H22O4 — CID 90682798
(1R,2S,3R,4S,5R)-5-[(1E,3E,5E)-hepta-1,3,5-trienyl]-4-(hydroxymethyl)cyclohexane-1,2,3-triol (PubChem CID 90682798) has the molecular formula C14H22O4 and a molecular weight of 254.33 g/mol. Its IUPAC name is (1R,2S,3R,4S,5R)-5-[(1E,3E,5E)-hepta-1,3,5-trienyl]-4-(hydroxymethyl)cyclohexane-1,2,3-triol.
| Compound Name | (1R,2S,3R,4S,5R)-5-[(1E,3E,5E)-hepta-1,3,5-trienyl]-4-(hydroxymethyl)cyclohexane-1,2,3-triol |
|---|---|
| PubChem CID | 90682798 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | (1R,2S,3R,4S,5R)-5-[(1E,3E,5E)-hepta-1,3,5-trienyl]-4-(hydroxymethyl)cyclohexane-1,2,3-triol |
| SMILES | C/C=C/C=C/C=C/[C@H]1C[C@@H](O)[C@H](O)[C@H](O)[C@@H]1CO |
| InChI | InChI=1S/C14H22O4/c1-2-3-4-5-6-7-10-8-12(16)14(18)13(17)11(10)9-15/h2-7,10-18H,8-9H2,1H3/b3-2+,5-4+,7-6+/t10-,11+,12+,13+,14-/m0/s1 |
| InChIKey | NSRGKZSBLPAZRE-KIAXAYBVSA-N |
| XLogP | 0.39 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|