About 5-butyl-N,N-bis(2-hydroxyethyl)-6-oxophenanthridine-2-carboxamide
5-butyl-N,N-bis(2-hydroxyethyl)-6-oxophenanthridine-2-carboxamide (PubChem CID 90682824) has the molecular formula C22H26N2O4
and a molecular weight of 382.46 g/mol. Its IUPAC name is 5-butyl-N,N-bis(2-hydroxyethyl)-6-oxophenanthridine-2-carboxamide.
Molecular Properties
| Compound Name | 5-butyl-N,N-bis(2-hydroxyethyl)-6-oxophenanthridine-2-carboxamide |
| PubChem CID | 90682824 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 5-butyl-N,N-bis(2-hydroxyethyl)-6-oxophenanthridine-2-carboxamide |
| SMILES | CCCCn1c(=O)c2ccccc2c2cc(C(=O)N(CCO)CCO)ccc21 |
| InChI | InChI=1S/C22H26N2O4/c1-2-3-10-24-20-9-8-16(21(27)23(11-13-25)12-14-26)15-19(20)17-6-4-5-7-18(17)22(24)28/h4-9,15,25-26H,2-3,10-14H2,1H3 |
| InChIKey | QUCKLGRPNCAZPM-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 82.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 5-butyl-N,N-bis(2-hydroxyethyl)-6-oxophenanthridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butyl-N,N-bis(2-hydroxyethyl)-6-oxophenanthridine-2-carboxamide?
The IUPAC name of 5-butyl-N,N-bis(2-hydroxyethyl)-6-oxophenanthridine-2-carboxamide (CID 90682824) is 5-butyl-N,N-bis(2-hydroxyethyl)-6-oxophenanthridine-2-carboxamide.
What is the SMILES notation for 5-butyl-N,N-bis(2-hydroxyethyl)-6-oxophenanthridine-2-carboxamide?
The canonical SMILES for 5-butyl-N,N-bis(2-hydroxyethyl)-6-oxophenanthridine-2-carboxamide is CCCCn1c(=O)c2ccccc2c2cc(C(=O)N(CCO)CCO)ccc21.
What is the InChIKey of 5-butyl-N,N-bis(2-hydroxyethyl)-6-oxophenanthridine-2-carboxamide?
The InChIKey is QUCKLGRPNCAZPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26N2O4/c1-2-3-10-24-20-9-8-16(21(27)23(11-13-25)12-14-26)15-19(20)17-6-4-5-7-18(17)22(24)28/h4-9,15,25-26H,2-3,10-14H2,1H3.
What are the key properties of 5-butyl-N,N-bis(2-hydroxyethyl)-6-oxophenanthridine-2-carboxamide?
5-butyl-N,N-bis(2-hydroxyethyl)-6-oxophenanthridine-2-carboxamide has a molecular weight of 382.46 g/mol, XLogP of 2.38, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butyl-N,N-bis(2-hydroxyethyl)-6-oxophenanthridine-2-carboxamide is sourced from PubChem (CID 90682824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).