About (2S)-1-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]pyrrolidine-2-carboxylic acid
(2S)-1-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]pyrrolidine-2-carboxylic acid (PubChem CID 90682922) has the molecular formula C14H17N5O5
and a molecular weight of 335.32 g/mol. Its IUPAC name is (2S)-1-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]pyrrolidine-2-carboxylic acid.
Molecular Properties
| Compound Name | (2S)-1-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]pyrrolidine-2-carboxylic acid |
| PubChem CID | 90682922 |
| Molecular Formula | C14H17N5O5 |
| Molecular Weight | 335.32 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | (2S)-1-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]pyrrolidine-2-carboxylic acid |
| SMILES | Cn1c(=O)c2c(ncn2CC(=O)N2CCC[C@H]2C(=O)O)n(C)c1=O |
| InChI | InChI=1S/C14H17N5O5/c1-16-11-10(12(21)17(2)14(16)24)18(7-15-11)6-9(20)19-5-3-4-8(19)13(22)23/h7-8H,3-6H2,1-2H3,(H,22,23)/t8-/m0/s1 |
| InChIKey | NZQIIGHNGPICFX-QMMMGPOBSA-N |
| XLogP | -1.49 |
| TPSA | 119.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.32 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze (2S)-1-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]pyrrolidine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]pyrrolidine-2-carboxylic acid?
The IUPAC name of (2S)-1-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]pyrrolidine-2-carboxylic acid (CID 90682922) is (2S)-1-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]pyrrolidine-2-carboxylic acid.
What is the SMILES notation for (2S)-1-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]pyrrolidine-2-carboxylic acid?
The canonical SMILES for (2S)-1-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]pyrrolidine-2-carboxylic acid is Cn1c(=O)c2c(ncn2CC(=O)N2CCC[C@H]2C(=O)O)n(C)c1=O.
What is the InChIKey of (2S)-1-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]pyrrolidine-2-carboxylic acid?
The InChIKey is NZQIIGHNGPICFX-QMMMGPOBSA-N. The full InChI is InChI=1S/C14H17N5O5/c1-16-11-10(12(21)17(2)14(16)24)18(7-15-11)6-9(20)19-5-3-4-8(19)13(22)23/h7-8H,3-6H2,1-2H3,(H,22,23)/t8-/m0/s1.
What are the key properties of (2S)-1-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]pyrrolidine-2-carboxylic acid?
(2S)-1-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]pyrrolidine-2-carboxylic acid has a molecular weight of 335.32 g/mol, XLogP of -1.49, 3 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]pyrrolidine-2-carboxylic acid is sourced from PubChem (CID 90682922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).