C9H12FN3O3Se — CID 90683007
4-amino-1-[(3S,4S,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)selenolan-2-yl]pyrimidin-2-one (PubChem CID 90683007) has the molecular formula C9H12FN3O3Se and a molecular weight of 308.17 g/mol. Its IUPAC name is 4-amino-1-[(3S,4S,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)selenolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(3S,4S,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)selenolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 90683007 |
| Molecular Formula | C9H12FN3O3Se |
| Molecular Weight | 308.17 g/mol |
| Exact Mass | 309.00 |
| IUPAC Name | 4-amino-1-[(3S,4S,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)selenolan-2-yl]pyrimidin-2-one |
| SMILES | Nc1ccn(C2[Se][C@H](CO)[C@@H](O)[C@@H]2F)c(=O)n1 |
| InChI | InChI=1S/C9H12FN3O3Se/c10-6-7(15)4(3-14)17-8(6)13-2-1-5(11)12-9(13)16/h1-2,4,6-8,14-15H,3H2,(H2,11,12,16)/t4-,6+,7-,8?/m1/s1 |
| InChIKey | GLESYYOUKBSQNJ-RQFJETTJSA-N |
| XLogP | -1.48 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.17 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|