C9H13N3O4Se — CID 90683008
4-amino-1-[(3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)selenolan-2-yl]pyrimidin-2-one (PubChem CID 90683008) has the molecular formula C9H13N3O4Se and a molecular weight of 306.18 g/mol. Its IUPAC name is 4-amino-1-[(3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)selenolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)selenolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 90683008 |
| Molecular Formula | C9H13N3O4Se |
| Molecular Weight | 306.18 g/mol |
| Exact Mass | 307.01 |
| IUPAC Name | 4-amino-1-[(3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)selenolan-2-yl]pyrimidin-2-one |
| SMILES | Nc1ccn(C2[Se][C@H](CO)[C@@H](O)[C@@H]2O)c(=O)n1 |
| InChI | InChI=1S/C9H13N3O4Se/c10-5-1-2-12(9(16)11-5)8-7(15)6(14)4(3-13)17-8/h1-2,4,6-8,13-15H,3H2,(H2,10,11,16)/t4-,6-,7+,8?/m1/s1 |
| InChIKey | YPPWIQQLCCWDTG-STUHELBRSA-N |
| XLogP | -2.46 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.18 |
| LogP ≤ 5 | -2.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|