About 1-cyclohexyl-5-[(3,5-dinitrophenyl)methylselanyl]tetrazole
1-cyclohexyl-5-[(3,5-dinitrophenyl)methylselanyl]tetrazole (PubChem CID 90683071) has the molecular formula C14H16N6O4Se
and a molecular weight of 411.28 g/mol. Its IUPAC name is 1-cyclohexyl-5-[(3,5-dinitrophenyl)methylselanyl]tetrazole.
Molecular Properties
| Compound Name | 1-cyclohexyl-5-[(3,5-dinitrophenyl)methylselanyl]tetrazole |
| PubChem CID | 90683071 |
| Molecular Formula | C14H16N6O4Se |
| Molecular Weight | 411.28 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | 1-cyclohexyl-5-[(3,5-dinitrophenyl)methylselanyl]tetrazole |
| SMILES | O=[N+]([O-])c1cc(C[Se]c2nnnn2C2CCCCC2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H16N6O4Se/c21-19(22)12-6-10(7-13(8-12)20(23)24)9-25-14-15-16-17-18(14)11-4-2-1-3-5-11/h6-8,11H,1-5,9H2 |
| InChIKey | JWBWMFKSHGCSEW-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 129.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.28 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexyl-5-[(3,5-dinitrophenyl)methylselanyl]tetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-5-[(3,5-dinitrophenyl)methylselanyl]tetrazole?
The IUPAC name of 1-cyclohexyl-5-[(3,5-dinitrophenyl)methylselanyl]tetrazole (CID 90683071) is 1-cyclohexyl-5-[(3,5-dinitrophenyl)methylselanyl]tetrazole.
What is the SMILES notation for 1-cyclohexyl-5-[(3,5-dinitrophenyl)methylselanyl]tetrazole?
The canonical SMILES for 1-cyclohexyl-5-[(3,5-dinitrophenyl)methylselanyl]tetrazole is O=[N+]([O-])c1cc(C[Se]c2nnnn2C2CCCCC2)cc([N+](=O)[O-])c1.
What is the InChIKey of 1-cyclohexyl-5-[(3,5-dinitrophenyl)methylselanyl]tetrazole?
The InChIKey is JWBWMFKSHGCSEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N6O4Se/c21-19(22)12-6-10(7-13(8-12)20(23)24)9-25-14-15-16-17-18(14)11-4-2-1-3-5-11/h6-8,11H,1-5,9H2.
What are the key properties of 1-cyclohexyl-5-[(3,5-dinitrophenyl)methylselanyl]tetrazole?
1-cyclohexyl-5-[(3,5-dinitrophenyl)methylselanyl]tetrazole has a molecular weight of 411.28 g/mol, XLogP of 1.52, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-5-[(3,5-dinitrophenyl)methylselanyl]tetrazole is sourced from PubChem (CID 90683071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).