C19H25NO4 — CID 90683087
3-[4-hydroxy-3-[[(2E,4E)-8-methylnona-2,4-dienoyl]amino]phenyl]propanoic acid (PubChem CID 90683087) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is 3-[4-hydroxy-3-[[(2E,4E)-8-methylnona-2,4-dienoyl]amino]phenyl]propanoic acid.
| Compound Name | 3-[4-hydroxy-3-[[(2E,4E)-8-methylnona-2,4-dienoyl]amino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 90683087 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | 3-[4-hydroxy-3-[[(2E,4E)-8-methylnona-2,4-dienoyl]amino]phenyl]propanoic acid |
| SMILES | CC(C)CC/C=C/C=C/C(=O)Nc1cc(CCC(=O)O)ccc1O |
| InChI | InChI=1S/C19H25NO4/c1-14(2)7-5-3-4-6-8-18(22)20-16-13-15(9-11-17(16)21)10-12-19(23)24/h3-4,6,8-9,11,13-14,21H,5,7,10,12H2,1-2H3,(H,20,22)(H,23,24)/b4-3+,8-6+ |
| InChIKey | MMOZVGGKBLJAHT-PBOULFJWSA-N |
| XLogP | 3.90 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|