C18H18F2N2O2 — CID 90683111
2-butoxy-6-(2,4-difluorophenyl)-7,8-dihydro-1,6-naphthyridin-5-one (PubChem CID 90683111) has the molecular formula C18H18F2N2O2 and a molecular weight of 332.35 g/mol. Its IUPAC name is 2-butoxy-6-(2,4-difluorophenyl)-7,8-dihydro-1,6-naphthyridin-5-one.
| Compound Name | 2-butoxy-6-(2,4-difluorophenyl)-7,8-dihydro-1,6-naphthyridin-5-one |
|---|---|
| PubChem CID | 90683111 |
| Molecular Formula | C18H18F2N2O2 |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 2-butoxy-6-(2,4-difluorophenyl)-7,8-dihydro-1,6-naphthyridin-5-one |
| SMILES | CCCCOc1ccc2c(n1)CCN(c1ccc(F)cc1F)C2=O |
| InChI | InChI=1S/C18H18F2N2O2/c1-2-3-10-24-17-7-5-13-15(21-17)8-9-22(18(13)23)16-6-4-12(19)11-14(16)20/h4-7,11H,2-3,8-10H2,1H3 |
| InChIKey | ILSAVHGBKQQODC-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|