About N-[(2S,3S)-3-hydroxytetradecan-2-yl]acetamide
N-[(2S,3S)-3-hydroxytetradecan-2-yl]acetamide (PubChem CID 90683236) has the molecular formula C16H33NO2
and a molecular weight of 271.44 g/mol. Its IUPAC name is N-[(2S,3S)-3-hydroxytetradecan-2-yl]acetamide.
Molecular Properties
| Compound Name | N-[(2S,3S)-3-hydroxytetradecan-2-yl]acetamide |
| PubChem CID | 90683236 |
| Molecular Formula | C16H33NO2 |
| Molecular Weight | 271.44 g/mol |
| Exact Mass | 271.25 |
| IUPAC Name | N-[(2S,3S)-3-hydroxytetradecan-2-yl]acetamide |
| SMILES | CCCCCCCCCCC[C@H](O)[C@H](C)NC(C)=O |
| InChI | InChI=1S/C16H33NO2/c1-4-5-6-7-8-9-10-11-12-13-16(19)14(2)17-15(3)18/h14,16,19H,4-13H2,1-3H3,(H,17,18)/t14-,16-/m0/s1 |
| InChIKey | IIHODMXLVYVECB-HOCLYGCPSA-N |
| XLogP | 3.79 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.44 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[(2S,3S)-3-hydroxytetradecan-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2S,3S)-3-hydroxytetradecan-2-yl]acetamide?
The IUPAC name of N-[(2S,3S)-3-hydroxytetradecan-2-yl]acetamide (CID 90683236) is N-[(2S,3S)-3-hydroxytetradecan-2-yl]acetamide.
What is the SMILES notation for N-[(2S,3S)-3-hydroxytetradecan-2-yl]acetamide?
The canonical SMILES for N-[(2S,3S)-3-hydroxytetradecan-2-yl]acetamide is CCCCCCCCCCC[C@H](O)[C@H](C)NC(C)=O.
What is the InChIKey of N-[(2S,3S)-3-hydroxytetradecan-2-yl]acetamide?
The InChIKey is IIHODMXLVYVECB-HOCLYGCPSA-N. The full InChI is InChI=1S/C16H33NO2/c1-4-5-6-7-8-9-10-11-12-13-16(19)14(2)17-15(3)18/h14,16,19H,4-13H2,1-3H3,(H,17,18)/t14-,16-/m0/s1.
What are the key properties of N-[(2S,3S)-3-hydroxytetradecan-2-yl]acetamide?
N-[(2S,3S)-3-hydroxytetradecan-2-yl]acetamide has a molecular weight of 271.44 g/mol, XLogP of 3.79, 12 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2S,3S)-3-hydroxytetradecan-2-yl]acetamide is sourced from PubChem (CID 90683236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).