About 1-(methylsulfanylmethyl)-3,5-dinitrobenzene
1-(methylsulfanylmethyl)-3,5-dinitrobenzene (PubChem CID 90683246) has the molecular formula C8H8N2O4S
and a molecular weight of 228.23 g/mol. Its IUPAC name is 1-(methylsulfanylmethyl)-3,5-dinitrobenzene.
Molecular Properties
| Compound Name | 1-(methylsulfanylmethyl)-3,5-dinitrobenzene |
| PubChem CID | 90683246 |
| Molecular Formula | C8H8N2O4S |
| Molecular Weight | 228.23 g/mol |
| Exact Mass | 228.02 |
| IUPAC Name | 1-(methylsulfanylmethyl)-3,5-dinitrobenzene |
| SMILES | CSCc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C8H8N2O4S/c1-15-5-6-2-7(9(11)12)4-8(3-6)10(13)14/h2-4H,5H2,1H3 |
| InChIKey | WNFNKTDYYOOWIS-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.23 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(methylsulfanylmethyl)-3,5-dinitrobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(methylsulfanylmethyl)-3,5-dinitrobenzene?
The IUPAC name of 1-(methylsulfanylmethyl)-3,5-dinitrobenzene (CID 90683246) is 1-(methylsulfanylmethyl)-3,5-dinitrobenzene.
What is the SMILES notation for 1-(methylsulfanylmethyl)-3,5-dinitrobenzene?
The canonical SMILES for 1-(methylsulfanylmethyl)-3,5-dinitrobenzene is CSCc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1.
What is the InChIKey of 1-(methylsulfanylmethyl)-3,5-dinitrobenzene?
The InChIKey is WNFNKTDYYOOWIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O4S/c1-15-5-6-2-7(9(11)12)4-8(3-6)10(13)14/h2-4H,5H2,1H3.
What are the key properties of 1-(methylsulfanylmethyl)-3,5-dinitrobenzene?
1-(methylsulfanylmethyl)-3,5-dinitrobenzene has a molecular weight of 228.23 g/mol, XLogP of 2.37, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(methylsulfanylmethyl)-3,5-dinitrobenzene is sourced from PubChem (CID 90683246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).