About (1R,2R)-1-(3,4-dichlorophenyl)-2-(2-methylbutan-2-ylamino)propan-1-ol
(1R,2R)-1-(3,4-dichlorophenyl)-2-(2-methylbutan-2-ylamino)propan-1-ol (PubChem CID 90683349) has the molecular formula C14H21Cl2NO
and a molecular weight of 290.23 g/mol. Its IUPAC name is (1R,2R)-1-(3,4-dichlorophenyl)-2-(2-methylbutan-2-ylamino)propan-1-ol.
Molecular Properties
| Compound Name | (1R,2R)-1-(3,4-dichlorophenyl)-2-(2-methylbutan-2-ylamino)propan-1-ol |
| PubChem CID | 90683349 |
| Molecular Formula | C14H21Cl2NO |
| Molecular Weight | 290.23 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | (1R,2R)-1-(3,4-dichlorophenyl)-2-(2-methylbutan-2-ylamino)propan-1-ol |
| SMILES | CCC(C)(C)N[C@H](C)[C@H](O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H21Cl2NO/c1-5-14(3,4)17-9(2)13(18)10-6-7-11(15)12(16)8-10/h6-9,13,17-18H,5H2,1-4H3/t9-,13+/m1/s1 |
| InChIKey | ZUVDVUBYPVXLLW-RNCFNFMXSA-N |
| XLogP | 4.19 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.23 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1R,2R)-1-(3,4-dichlorophenyl)-2-(2-methylbutan-2-ylamino)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,2R)-1-(3,4-dichlorophenyl)-2-(2-methylbutan-2-ylamino)propan-1-ol?
The IUPAC name of (1R,2R)-1-(3,4-dichlorophenyl)-2-(2-methylbutan-2-ylamino)propan-1-ol (CID 90683349) is (1R,2R)-1-(3,4-dichlorophenyl)-2-(2-methylbutan-2-ylamino)propan-1-ol.
What is the SMILES notation for (1R,2R)-1-(3,4-dichlorophenyl)-2-(2-methylbutan-2-ylamino)propan-1-ol?
The canonical SMILES for (1R,2R)-1-(3,4-dichlorophenyl)-2-(2-methylbutan-2-ylamino)propan-1-ol is CCC(C)(C)N[C@H](C)[C@H](O)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of (1R,2R)-1-(3,4-dichlorophenyl)-2-(2-methylbutan-2-ylamino)propan-1-ol?
The InChIKey is ZUVDVUBYPVXLLW-RNCFNFMXSA-N. The full InChI is InChI=1S/C14H21Cl2NO/c1-5-14(3,4)17-9(2)13(18)10-6-7-11(15)12(16)8-10/h6-9,13,17-18H,5H2,1-4H3/t9-,13+/m1/s1.
What are the key properties of (1R,2R)-1-(3,4-dichlorophenyl)-2-(2-methylbutan-2-ylamino)propan-1-ol?
(1R,2R)-1-(3,4-dichlorophenyl)-2-(2-methylbutan-2-ylamino)propan-1-ol has a molecular weight of 290.23 g/mol, XLogP of 4.19, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,2R)-1-(3,4-dichlorophenyl)-2-(2-methylbutan-2-ylamino)propan-1-ol is sourced from PubChem (CID 90683349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).