C13H13F3N4O3 — CID 90683354
(1R,9S,10S,14S)-14-hydroxy-13-methyl-4-(trifluoromethyl)-2,8,11,13-tetrazatetracyclo[7.6.0.02,6.010,14]pentadeca-3,5-diene-7,12-dione (PubChem CID 90683354) has the molecular formula C13H13F3N4O3 and a molecular weight of 330.27 g/mol. Its IUPAC name is (1R,9S,10S,14S)-14-hydroxy-13-methyl-4-(trifluoromethyl)-2,8,11,13-tetrazatetracyclo[7.6.0.02,6.010,14]pentadeca-3,5-diene-7,12-dione.
| Compound Name | (1R,9S,10S,14S)-14-hydroxy-13-methyl-4-(trifluoromethyl)-2,8,11,13-tetrazatetracyclo[7.6.0.02,6.010,14]pentadeca-3,5-diene-7,12-dione |
|---|---|
| PubChem CID | 90683354 |
| Molecular Formula | C13H13F3N4O3 |
| Molecular Weight | 330.27 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | (1R,9S,10S,14S)-14-hydroxy-13-methyl-4-(trifluoromethyl)-2,8,11,13-tetrazatetracyclo[7.6.0.02,6.010,14]pentadeca-3,5-diene-7,12-dione |
| SMILES | CN1C(=O)N[C@H]2[C@@H]3NC(=O)c4cc(C(F)(F)F)cn4[C@@H]3C[C@]21O |
| InChI | InChI=1S/C13H13F3N4O3/c1-19-11(22)18-9-8-7(3-12(9,19)23)20-4-5(13(14,15)16)2-6(20)10(21)17-8/h2,4,7-9,23H,3H2,1H3,(H,17,21)(H,18,22)/t7-,8-,9+,12+/m1/s1 |
| InChIKey | GSSNBESWGLFCQW-XBWDGYHZSA-N |
| XLogP | 0.28 |
| TPSA | 86.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.27 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |