C13H15BrN4O3 — CID 90683357
(1R,9S,10S,14S)-3-bromo-14-methoxy-8-methyl-2,8,11,13-tetrazatetracyclo[7.6.0.02,6.010,14]pentadeca-3,5-diene-7,12-dione (PubChem CID 90683357) has the molecular formula C13H15BrN4O3 and a molecular weight of 355.19 g/mol. Its IUPAC name is (1R,9S,10S,14S)-3-bromo-14-methoxy-8-methyl-2,8,11,13-tetrazatetracyclo[7.6.0.02,6.010,14]pentadeca-3,5-diene-7,12-dione.
| Compound Name | (1R,9S,10S,14S)-3-bromo-14-methoxy-8-methyl-2,8,11,13-tetrazatetracyclo[7.6.0.02,6.010,14]pentadeca-3,5-diene-7,12-dione |
|---|---|
| PubChem CID | 90683357 |
| Molecular Formula | C13H15BrN4O3 |
| Molecular Weight | 355.19 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | (1R,9S,10S,14S)-3-bromo-14-methoxy-8-methyl-2,8,11,13-tetrazatetracyclo[7.6.0.02,6.010,14]pentadeca-3,5-diene-7,12-dione |
| SMILES | CO[C@@]12C[C@@H]3[C@H]([C@@H]1NC(=O)N2)N(C)C(=O)c1ccc(Br)n13 |
| InChI | InChI=1S/C13H15BrN4O3/c1-17-9-7(18-6(11(17)19)3-4-8(18)14)5-13(21-2)10(9)15-12(20)16-13/h3-4,7,9-10H,5H2,1-2H3,(H2,15,16,20)/t7-,9-,10+,13+/m1/s1 |
| InChIKey | LSPKDWJORCFXDG-PZWLIILKSA-N |
| XLogP | 0.67 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.19 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |