C24H27ClF3N7O2 — CID 90684086
3-[4-(5-chloro-3-pyridinyl)-3-[(4-methylcyclohexyl)methyl]-2-[methyl(2,2,2-trifluoroethyl)amino]imidazo[4,5-c]pyridin-6-yl]-1,2,4-oxadiazolidin-5-one (PubChem CID 90684086) has the molecular formula C24H27ClF3N7O2 and a molecular weight of 537.97 g/mol. Its IUPAC name is 3-[4-(5-chloro-3-pyridinyl)-3-[(4-methylcyclohexyl)methyl]-2-[methyl(2,2,2-trifluoroethyl)amino]imidazo[4,5-c]pyridin-6-yl]-1,2,4-oxadiazolidin-5-one.
| Compound Name | 3-[4-(5-chloro-3-pyridinyl)-3-[(4-methylcyclohexyl)methyl]-2-[methyl(2,2,2-trifluoroethyl)amino]imidazo[4,5-c]pyridin-6-yl]-1,2,4-oxadiazolidin-5-one |
|---|---|
| PubChem CID | 90684086 |
| Molecular Formula | C24H27ClF3N7O2 |
| Molecular Weight | 537.97 g/mol |
| Exact Mass | 537.19 |
| IUPAC Name | 3-[4-(5-chloro-3-pyridinyl)-3-[(4-methylcyclohexyl)methyl]-2-[methyl(2,2,2-trifluoroethyl)amino]imidazo[4,5-c]pyridin-6-yl]-1,2,4-oxadiazolidin-5-one |
| SMILES | CC1CCC(Cn2c(N(C)CC(F)(F)F)nc3cc(C4NOC(=O)N4)nc(-c4cncc(Cl)c4)c32)CC1 |
| InChI | InChI=1S/C24H27ClF3N7O2/c1-13-3-5-14(6-4-13)11-35-20-17(31-22(35)34(2)12-24(26,27)28)8-18(21-32-23(36)37-33-21)30-19(20)15-7-16(25)10-29-9-15/h7-10,13-14,21,33H,3-6,11-12H2,1-2H3,(H,32,36) |
| InChIKey | HXQYGPHKPINWNY-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 97.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.97 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |