About 4-[4-(2,3-dimethylphenyl)phenyl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide
4-[4-(2,3-dimethylphenyl)phenyl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide (PubChem CID 90684273) has the molecular formula C20H25NO4S
and a molecular weight of 375.49 g/mol. Its IUPAC name is 4-[4-(2,3-dimethylphenyl)phenyl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide.
Molecular Properties
| Compound Name | 4-[4-(2,3-dimethylphenyl)phenyl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide |
| PubChem CID | 90684273 |
| Molecular Formula | C20H25NO4S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | 4-[4-(2,3-dimethylphenyl)phenyl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide |
| SMILES | Cc1cccc(-c2ccc(CCC(C)(C(=O)NO)S(C)(=O)=O)cc2)c1C |
| InChI | InChI=1S/C20H25NO4S/c1-14-6-5-7-18(15(14)2)17-10-8-16(9-11-17)12-13-20(3,19(22)21-23)26(4,24)25/h5-11,23H,12-13H2,1-4H3,(H,21,22) |
| InChIKey | CMLYWAPGWQPCIU-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-(2,3-dimethylphenyl)phenyl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(2,3-dimethylphenyl)phenyl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide?
The IUPAC name of 4-[4-(2,3-dimethylphenyl)phenyl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide (CID 90684273) is 4-[4-(2,3-dimethylphenyl)phenyl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide.
What is the SMILES notation for 4-[4-(2,3-dimethylphenyl)phenyl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide?
The canonical SMILES for 4-[4-(2,3-dimethylphenyl)phenyl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide is Cc1cccc(-c2ccc(CCC(C)(C(=O)NO)S(C)(=O)=O)cc2)c1C.
What is the InChIKey of 4-[4-(2,3-dimethylphenyl)phenyl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide?
The InChIKey is CMLYWAPGWQPCIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25NO4S/c1-14-6-5-7-18(15(14)2)17-10-8-16(9-11-17)12-13-20(3,19(22)21-23)26(4,24)25/h5-11,23H,12-13H2,1-4H3,(H,21,22).
What are the key properties of 4-[4-(2,3-dimethylphenyl)phenyl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide?
4-[4-(2,3-dimethylphenyl)phenyl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide has a molecular weight of 375.49 g/mol, XLogP of 3.21, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(2,3-dimethylphenyl)phenyl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide is sourced from PubChem (CID 90684273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).