C17H29O3P — CID 90684380
[(5Z,8Z,11Z,14Z)-hexadeca-5,8,11,14-tetraenyl]-methoxyphosphinic acid (PubChem CID 90684380) has the molecular formula C17H29O3P and a molecular weight of 312.39 g/mol. Its IUPAC name is [(5Z,8Z,11Z,14Z)-hexadeca-5,8,11,14-tetraenyl]-methoxyphosphinic acid.
| Compound Name | [(5Z,8Z,11Z,14Z)-hexadeca-5,8,11,14-tetraenyl]-methoxyphosphinic acid |
|---|---|
| PubChem CID | 90684380 |
| Molecular Formula | C17H29O3P |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | [(5Z,8Z,11Z,14Z)-hexadeca-5,8,11,14-tetraenyl]-methoxyphosphinic acid |
| SMILES | C/C=C\C/C=C\C/C=C\C/C=C\CCCCP(=O)(O)OC |
| InChI | InChI=1S/C17H29O3P/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(18,19)20-2/h3-4,6-7,9-10,12-13H,5,8,11,14-17H2,1-2H3,(H,18,19)/b4-3-,7-6-,10-9-,13-12- |
| InChIKey | NHCDVGBTSZMOAT-LTKCOYKYSA-N |
| XLogP | 5.40 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|