C16H27O3P — CID 90684382
methoxy-[(5Z,8Z,11Z)-pentadeca-5,8,11,14-tetraenyl]phosphinic acid (PubChem CID 90684382) has the molecular formula C16H27O3P and a molecular weight of 298.36 g/mol. Its IUPAC name is methoxy-[(5Z,8Z,11Z)-pentadeca-5,8,11,14-tetraenyl]phosphinic acid.
| Compound Name | methoxy-[(5Z,8Z,11Z)-pentadeca-5,8,11,14-tetraenyl]phosphinic acid |
|---|---|
| PubChem CID | 90684382 |
| Molecular Formula | C16H27O3P |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | methoxy-[(5Z,8Z,11Z)-pentadeca-5,8,11,14-tetraenyl]phosphinic acid |
| SMILES | C=CC/C=C\C/C=C\C/C=C\CCCCP(=O)(O)OC |
| InChI | InChI=1S/C16H27O3P/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-20(17,18)19-2/h3,5-6,8-9,11-12H,1,4,7,10,13-16H2,2H3,(H,17,18)/b6-5-,9-8-,12-11- |
| InChIKey | CVQNNJLTTZCBSA-AGRJPVHOSA-N |
| XLogP | 5.01 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|