C22H22Cl2N4O3S — CID 90684601
[8-[(2-chlorophenyl)carbamothioyl]-1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl] N-[(4-chlorophenyl)methyl]carbamate (PubChem CID 90684601) has the molecular formula C22H22Cl2N4O3S and a molecular weight of 493.42 g/mol. Its IUPAC name is [8-[(2-chlorophenyl)carbamothioyl]-1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl] N-[(4-chlorophenyl)methyl]carbamate.
| Compound Name | [8-[(2-chlorophenyl)carbamothioyl]-1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl] N-[(4-chlorophenyl)methyl]carbamate |
|---|---|
| PubChem CID | 90684601 |
| Molecular Formula | C22H22Cl2N4O3S |
| Molecular Weight | 493.42 g/mol |
| Exact Mass | 492.08 |
| IUPAC Name | [8-[(2-chlorophenyl)carbamothioyl]-1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl] N-[(4-chlorophenyl)methyl]carbamate |
| SMILES | O=C(NCc1ccc(Cl)cc1)OC1=CC2(CCN(C(=S)Nc3ccccc3Cl)CC2)ON1 |
| InChI | InChI=1S/C22H22Cl2N4O3S/c23-16-7-5-15(6-8-16)14-25-21(29)30-19-13-22(31-27-19)9-11-28(12-10-22)20(32)26-18-4-2-1-3-17(18)24/h1-8,13,27H,9-12,14H2,(H,25,29)(H,26,32) |
| InChIKey | JXFGFOQZNCQPAZ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 74.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.42 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|