C11H20N2 — CID 90684755
N'-[(2E)-5,6,6-trimethylhepta-2,4-dien-3-yl]methanimidamide (PubChem CID 90684755) has the molecular formula C11H20N2 and a molecular weight of 180.29 g/mol. Its IUPAC name is N'-[(2E)-5,6,6-trimethylhepta-2,4-dien-3-yl]methanimidamide.
| Compound Name | N'-[(2E)-5,6,6-trimethylhepta-2,4-dien-3-yl]methanimidamide |
|---|---|
| PubChem CID | 90684755 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | N'-[(2E)-5,6,6-trimethylhepta-2,4-dien-3-yl]methanimidamide |
| SMILES | C/C=C(C=C(C)C(C)(C)C)/N=C/N |
| InChI | InChI=1S/C11H20N2/c1-6-10(13-8-12)7-9(2)11(3,4)5/h6-8H,1-5H3,(H2,12,13)/b9-7?,10-6+ |
| InChIKey | XRMYCJZNCGTKOG-CWIDIXFLSA-N |
| XLogP | 2.87 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|