C8H13F9N2O3 — CID 90684882
1-(2-ethoxyethyl)-3-(fluoroamino)pyrrolidine-2,5-dione;molecular fluorine (PubChem CID 90684882) has the molecular formula C8H13F9N2O3 and a molecular weight of 356.19 g/mol. Its IUPAC name is 1-(2-ethoxyethyl)-3-(fluoroamino)pyrrolidine-2,5-dione;molecular fluorine.
| Compound Name | 1-(2-ethoxyethyl)-3-(fluoroamino)pyrrolidine-2,5-dione;molecular fluorine |
|---|---|
| PubChem CID | 90684882 |
| Molecular Formula | C8H13F9N2O3 |
| Molecular Weight | 356.19 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | 1-(2-ethoxyethyl)-3-(fluoroamino)pyrrolidine-2,5-dione;molecular fluorine |
| SMILES | CCOCCN1C(=O)CC(NF)C1=O.FF.FF.FF.FF |
| InChI | InChI=1S/C8H13FN2O3.4F2/c1-2-14-4-3-11-7(12)5-6(10-9)8(11)13;4*1-2/h6,10H,2-5H2,1H3;;;; |
| InChIKey | CECHRIMOFFMWIZ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.19 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|