About [5-(2,4-difluorophenoxy)-6-(4-methylsulfonylphenyl)-4-oxopyran-2-yl]methyl acetate
[5-(2,4-difluorophenoxy)-6-(4-methylsulfonylphenyl)-4-oxopyran-2-yl]methyl acetate (PubChem CID 90685029) has the molecular formula C21H16F2O7S
and a molecular weight of 450.42 g/mol. Its IUPAC name is [5-(2,4-difluorophenoxy)-6-(4-methylsulfonylphenyl)-4-oxopyran-2-yl]methyl acetate.
Molecular Properties
| Compound Name | [5-(2,4-difluorophenoxy)-6-(4-methylsulfonylphenyl)-4-oxopyran-2-yl]methyl acetate |
| PubChem CID | 90685029 |
| Molecular Formula | C21H16F2O7S |
| Molecular Weight | 450.42 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | [5-(2,4-difluorophenoxy)-6-(4-methylsulfonylphenyl)-4-oxopyran-2-yl]methyl acetate |
| SMILES | CC(=O)OCc1cc(=O)c(Oc2ccc(F)cc2F)c(-c2ccc(S(C)(=O)=O)cc2)o1 |
| InChI | InChI=1S/C21H16F2O7S/c1-12(24)28-11-15-10-18(25)21(30-19-8-5-14(22)9-17(19)23)20(29-15)13-3-6-16(7-4-13)31(2,26)27/h3-10H,11H2,1-2H3 |
| InChIKey | HDTJKCFXYMUHAK-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 99.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 450.42 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [5-(2,4-difluorophenoxy)-6-(4-methylsulfonylphenyl)-4-oxopyran-2-yl]methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(2,4-difluorophenoxy)-6-(4-methylsulfonylphenyl)-4-oxopyran-2-yl]methyl acetate?
The IUPAC name of [5-(2,4-difluorophenoxy)-6-(4-methylsulfonylphenyl)-4-oxopyran-2-yl]methyl acetate (CID 90685029) is [5-(2,4-difluorophenoxy)-6-(4-methylsulfonylphenyl)-4-oxopyran-2-yl]methyl acetate.
What is the SMILES notation for [5-(2,4-difluorophenoxy)-6-(4-methylsulfonylphenyl)-4-oxopyran-2-yl]methyl acetate?
The canonical SMILES for [5-(2,4-difluorophenoxy)-6-(4-methylsulfonylphenyl)-4-oxopyran-2-yl]methyl acetate is CC(=O)OCc1cc(=O)c(Oc2ccc(F)cc2F)c(-c2ccc(S(C)(=O)=O)cc2)o1.
What is the InChIKey of [5-(2,4-difluorophenoxy)-6-(4-methylsulfonylphenyl)-4-oxopyran-2-yl]methyl acetate?
The InChIKey is HDTJKCFXYMUHAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16F2O7S/c1-12(24)28-11-15-10-18(25)21(30-19-8-5-14(22)9-17(19)23)20(29-15)13-3-6-16(7-4-13)31(2,26)27/h3-10H,11H2,1-2H3.
What are the key properties of [5-(2,4-difluorophenoxy)-6-(4-methylsulfonylphenyl)-4-oxopyran-2-yl]methyl acetate?
[5-(2,4-difluorophenoxy)-6-(4-methylsulfonylphenyl)-4-oxopyran-2-yl]methyl acetate has a molecular weight of 450.42 g/mol, XLogP of 3.84, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(2,4-difluorophenoxy)-6-(4-methylsulfonylphenyl)-4-oxopyran-2-yl]methyl acetate is sourced from PubChem (CID 90685029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).