C29H24N2O2 — CID 90685061
2-cyano-5-[4-(4-phenylphenyl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]penta-2,4-dienoic acid (PubChem CID 90685061) has the molecular formula C29H24N2O2 and a molecular weight of 432.52 g/mol. Its IUPAC name is 2-cyano-5-[4-(4-phenylphenyl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]penta-2,4-dienoic acid.
| Compound Name | 2-cyano-5-[4-(4-phenylphenyl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 90685061 |
| Molecular Formula | C29H24N2O2 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 2-cyano-5-[4-(4-phenylphenyl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]penta-2,4-dienoic acid |
| SMILES | N#CC(=CC=Cc1ccc2c(c1)C1CCCC1N2c1ccc(-c2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C29H24N2O2/c30-19-23(29(32)33)9-4-6-20-12-17-28-26(18-20)25-10-5-11-27(25)31(28)24-15-13-22(14-16-24)21-7-2-1-3-8-21/h1-4,6-9,12-18,25,27H,5,10-11H2,(H,32,33) |
| InChIKey | QGOLARKYYLHVAW-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|