About 3-amino-1-(2-methoxyethyl)pyrrole-2,5-diol
3-amino-1-(2-methoxyethyl)pyrrole-2,5-diol (PubChem CID 90685159) has the molecular formula C7H12N2O3
and a molecular weight of 172.18 g/mol. Its IUPAC name is 3-amino-1-(2-methoxyethyl)pyrrole-2,5-diol.
Molecular Properties
| Compound Name | 3-amino-1-(2-methoxyethyl)pyrrole-2,5-diol |
| PubChem CID | 90685159 |
| Molecular Formula | C7H12N2O3 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | 3-amino-1-(2-methoxyethyl)pyrrole-2,5-diol |
| SMILES | COCCn1c(O)cc(N)c1O |
| InChI | InChI=1S/C7H12N2O3/c1-12-3-2-9-6(10)4-5(8)7(9)11/h4,10-11H,2-3,8H2,1H3 |
| InChIKey | NYHZVZGJWHYOOF-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-amino-1-(2-methoxyethyl)pyrrole-2,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1-(2-methoxyethyl)pyrrole-2,5-diol?
The IUPAC name of 3-amino-1-(2-methoxyethyl)pyrrole-2,5-diol (CID 90685159) is 3-amino-1-(2-methoxyethyl)pyrrole-2,5-diol.
What is the SMILES notation for 3-amino-1-(2-methoxyethyl)pyrrole-2,5-diol?
The canonical SMILES for 3-amino-1-(2-methoxyethyl)pyrrole-2,5-diol is COCCn1c(O)cc(N)c1O.
What is the InChIKey of 3-amino-1-(2-methoxyethyl)pyrrole-2,5-diol?
The InChIKey is NYHZVZGJWHYOOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O3/c1-12-3-2-9-6(10)4-5(8)7(9)11/h4,10-11H,2-3,8H2,1H3.
What are the key properties of 3-amino-1-(2-methoxyethyl)pyrrole-2,5-diol?
3-amino-1-(2-methoxyethyl)pyrrole-2,5-diol has a molecular weight of 172.18 g/mol, XLogP of 0.13, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1-(2-methoxyethyl)pyrrole-2,5-diol is sourced from PubChem (CID 90685159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).