About N-heptadecyl-2,3-dihydroxypropanamide
N-heptadecyl-2,3-dihydroxypropanamide (PubChem CID 90685378) has the molecular formula C20H41NO3
and a molecular weight of 343.55 g/mol. Its IUPAC name is N-heptadecyl-2,3-dihydroxypropanamide.
Molecular Properties
| Compound Name | N-heptadecyl-2,3-dihydroxypropanamide |
| PubChem CID | 90685378 |
| Molecular Formula | C20H41NO3 |
| Molecular Weight | 343.55 g/mol |
| Exact Mass | 343.31 |
| IUPAC Name | N-heptadecyl-2,3-dihydroxypropanamide |
| SMILES | CCCCCCCCCCCCCCCCCNC(=O)C(O)CO |
| InChI | InChI=1S/C20H41NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21-20(24)19(23)18-22/h19,22-23H,2-18H2,1H3,(H,21,24) |
| InChIKey | PEHBDNFXHOTAGW-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.55 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-heptadecyl-2,3-dihydroxypropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-heptadecyl-2,3-dihydroxypropanamide?
The IUPAC name of N-heptadecyl-2,3-dihydroxypropanamide (CID 90685378) is N-heptadecyl-2,3-dihydroxypropanamide.
What is the SMILES notation for N-heptadecyl-2,3-dihydroxypropanamide?
The canonical SMILES for N-heptadecyl-2,3-dihydroxypropanamide is CCCCCCCCCCCCCCCCCNC(=O)C(O)CO.
What is the InChIKey of N-heptadecyl-2,3-dihydroxypropanamide?
The InChIKey is PEHBDNFXHOTAGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H41NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21-20(24)19(23)18-22/h19,22-23H,2-18H2,1H3,(H,21,24).
What are the key properties of N-heptadecyl-2,3-dihydroxypropanamide?
N-heptadecyl-2,3-dihydroxypropanamide has a molecular weight of 343.55 g/mol, XLogP of 4.33, 18 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-heptadecyl-2,3-dihydroxypropanamide is sourced from PubChem (CID 90685378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).