C25H26O6 — CID 90685753
(3S,4R,5S)-3,4,5,6-tetrahydroxy-1-trityloxyhexan-2-one (PubChem CID 90685753) has the molecular formula C25H26O6 and a molecular weight of 422.48 g/mol. Its IUPAC name is (3S,4R,5S)-3,4,5,6-tetrahydroxy-1-trityloxyhexan-2-one.
| Compound Name | (3S,4R,5S)-3,4,5,6-tetrahydroxy-1-trityloxyhexan-2-one |
|---|---|
| PubChem CID | 90685753 |
| Molecular Formula | C25H26O6 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | (3S,4R,5S)-3,4,5,6-tetrahydroxy-1-trityloxyhexan-2-one |
| SMILES | O=C(COC(c1ccccc1)(c1ccccc1)c1ccccc1)[C@@H](O)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C25H26O6/c26-16-21(27)23(29)24(30)22(28)17-31-25(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-15,21,23-24,26-27,29-30H,16-17H2/t21-,23+,24+/m0/s1 |
| InChIKey | VCJPUZLQEVLWMS-QPTUXGOLSA-N |
| XLogP | 1.64 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|