About 3-[(4-amino-2-oxo-1H-quinazolin-5-yl)oxy]-2,2-dimethylhexanamide
3-[(4-amino-2-oxo-1H-quinazolin-5-yl)oxy]-2,2-dimethylhexanamide (PubChem CID 90685828) has the molecular formula C16H22N4O3
and a molecular weight of 318.38 g/mol. Its IUPAC name is 3-[(4-amino-2-oxo-1H-quinazolin-5-yl)oxy]-2,2-dimethylhexanamide.
Molecular Properties
| Compound Name | 3-[(4-amino-2-oxo-1H-quinazolin-5-yl)oxy]-2,2-dimethylhexanamide |
| PubChem CID | 90685828 |
| Molecular Formula | C16H22N4O3 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 3-[(4-amino-2-oxo-1H-quinazolin-5-yl)oxy]-2,2-dimethylhexanamide |
| SMILES | CCCC(Oc1cccc2[nH]c(=O)nc(N)c12)C(C)(C)C(N)=O |
| InChI | InChI=1S/C16H22N4O3/c1-4-6-11(16(2,3)14(18)21)23-10-8-5-7-9-12(10)13(17)20-15(22)19-9/h5,7-8,11H,4,6H2,1-3H3,(H2,18,21)(H3,17,19,20,22) |
| InChIKey | CYIIHSSBTUUSMX-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 124.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(4-amino-2-oxo-1H-quinazolin-5-yl)oxy]-2,2-dimethylhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-amino-2-oxo-1H-quinazolin-5-yl)oxy]-2,2-dimethylhexanamide?
The IUPAC name of 3-[(4-amino-2-oxo-1H-quinazolin-5-yl)oxy]-2,2-dimethylhexanamide (CID 90685828) is 3-[(4-amino-2-oxo-1H-quinazolin-5-yl)oxy]-2,2-dimethylhexanamide.
What is the SMILES notation for 3-[(4-amino-2-oxo-1H-quinazolin-5-yl)oxy]-2,2-dimethylhexanamide?
The canonical SMILES for 3-[(4-amino-2-oxo-1H-quinazolin-5-yl)oxy]-2,2-dimethylhexanamide is CCCC(Oc1cccc2[nH]c(=O)nc(N)c12)C(C)(C)C(N)=O.
What is the InChIKey of 3-[(4-amino-2-oxo-1H-quinazolin-5-yl)oxy]-2,2-dimethylhexanamide?
The InChIKey is CYIIHSSBTUUSMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N4O3/c1-4-6-11(16(2,3)14(18)21)23-10-8-5-7-9-12(10)13(17)20-15(22)19-9/h5,7-8,11H,4,6H2,1-3H3,(H2,18,21)(H3,17,19,20,22).
What are the key properties of 3-[(4-amino-2-oxo-1H-quinazolin-5-yl)oxy]-2,2-dimethylhexanamide?
3-[(4-amino-2-oxo-1H-quinazolin-5-yl)oxy]-2,2-dimethylhexanamide has a molecular weight of 318.38 g/mol, XLogP of 1.56, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-amino-2-oxo-1H-quinazolin-5-yl)oxy]-2,2-dimethylhexanamide is sourced from PubChem (CID 90685828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).